On Target NMDZ1_HUMAN 0.12435233/CHEMBL162400
For the given ligand TCA, we have found in our database that, being scored 0.12435233, the most similar ligand is CHEMBL162400. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL162400 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC(=O)c1ccc(N2C(=O)CN(Cc3c(C(=O)O)[nH]c4cc(Cl)cc(Cl)c34)C2=O)cc1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 1001c006 09802800 00000120 d4010e10 000c1020 0000c020 04004084 0a003009 00000300 00090a48 09280004 4000a800 0600888e 0070a400 800204c0 020c000c 0006c008 02c0200c 08200040 00000001 c0120100 28078fe8 20822002 8240011e 00146000 c0000400 08044000 80000080 08008104 00060003 e004c200 80424620 |