On Target PERM_HUMAN 0.17829457/CHEMBL278555
For the given ligand TCA, we have found in our database that, being scored 0.17829457, the most similar ligand is CHEMBL278555. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL278555 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00000002 00000808 00000100 c1810710 00041010 00004000 00002000 00000000 00400900 00090840 08101004 4000b000 1c008800 00410800 00001040 020c100c 00020000 02000000 00600408 00000001 40000120 18008a28 23800040 81400010 00043c01 80002000 08080000 00000000 04000200 00060002 40040200 02000420 |