On Target TRPV1_RAT 0.4140625/CHEMBL98634
For the given ligand TCA, we have found in our database that, being scored 0.4140625, the most similar ligand is CHEMBL98634. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL98634 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | COc1cc(CC(=O)OCC2=C[C@H]3[C@@H]4C(C)(C)[C@]4(OC(=O)Cc4ccccc4)C[C@@H](C)C3(O)[C@@H]3C=C(C)C(=O)[C@@]3(OC)C2)ccc1O |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050040 c3000008 20000908 80010300 00381041 00000800 02000280 28000442 01000000 01180848 48000200 4000d000 0502c02a 23800000 41040405 00089008 08820000 82000000 37492010 0202a201 00010020 08000a80 0100a000 00400010 00201480 80200400 00524200 80011000 00000200 80020002 24022000 00800410 |