On Target PAR1_HUMAN 0.37398374/CHEMBL234804
For the given ligand TCA, we have found in our database that, being scored 0.37398374, the most similar ligand is CHEMBL234804. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL234804 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | Cc1cccc(/C=C/[C@H]2[C@@H]3CCCCC3=C[C@H]3C(=O)O[C@H](C)[C@@H]23)n1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050042 81000000 00804b00 90010700 000d0021 04000000 800000c0 0800040a 00000040 08108048 00000204 40409000 04028808 00800000 010a0406 020c100c 00820400 0a000020 02602000 0000a001 40000020 08009a00 2180a020 00410010 01200400 82000000 00406240 c0009200 00400204 00060002 24020000 00000000 |