On Target SC6A4_HUMAN 0.41025642/CHEMBL185169
For the given ligand TCA, we have found in our database that, being scored 0.41025642, the most similar ligand is CHEMBL185169. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL185169 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | COC(=O)C1=C(c2ccc3ccccc3c2)CC2CCC1O2 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050040 01000008 00000b02 00010300 000c0040 00200800 82000280 28000402 01800800 01180848 48100200 40009000 14028008 00a00000 00080406 00081008 00820400 02000000 2141a018 00008001 20000120 18001a88 0100a060 00400010 01201480 80000400 00406000 c0000400 00400202 00020002 24020000 00000410 |