On Target MK01_HUMAN 0.53763443/CHEMBL517080
For the given ligand TCA, we have found in our database that, being scored 0.53763443, the most similar ligand is CHEMBL517080. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL517080 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC1=C(CO)C(=O)O[C@@H]([C@@H](C)[C@H]2CC[C@H]3[C@@H]4C[C@H]5O[C@]56[C@@H](O)C=CC(=O)[C@]6(C)[C@H]4CC[C@@]32C)C1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050040 81000000 00000900 80010300 000c00c0 00200000 02000280 28000402 01000000 01108008 40040200 40009000 14028008 00800000 00000404 00089008 00820000 00000020 23412010 0000a001 20000020 00001a80 0500a000 08000010 00201400 00000400 00406000 80000020 00000200 01000002 24020000 00000010 |