On Target TRPV3_HUMAN 0.17834395/CHEMBL3664218
For the given ligand TCA, we have found in our database that, being scored 0.17834395, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc3ccc(Cl)cc32)c1OC1CCCC1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |