On Target AMPN_HUMAN 0.24/CHEMBL3298946
For the given ligand TCA, we have found in our database that, being scored 0.24, the most similar ligand is CHEMBL3298946. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3298946 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCOCC[C@H](N)CS.O=C(O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00000000 00000000 00100000 00110500 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40088000 00008000 040c0000 00000000 00081008 00200000 00000000 00c00000 00000005 00000020 10000a00 01000100 00400010 00000400 00000000 00000000 90000000 00000200 00040000 00000000 03010200 |