On Target AOFA_HUMAN 0.33035713/CHEMBL332223
For the given ligand TCA, we have found in our database that, being scored 0.33035713, the most similar ligand is CHEMBL332223. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL332223 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCOC(=O)C1=Cc2ccccc2CC1=O |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 10090000 01000000 00000302 00110300 200c0000 00200000 82000080 00000400 01800900 00180842 48102000 40009000 15028000 00200000 40000022 0008100a 00820400 02000000 20418018 00000001 00100120 08000a00 0100c020 00400010 01001400 80000101 00402000 c0000400 00400200 00020002 04002020 00410410 |