On Target PPARG_HUMAN 0.77272725/CHEMBL2178586
For the given ligand TCA, we have found in our database that, being scored 0.77272725, the most similar ligand is CHEMBL2178586. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL2178586 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCC1=C[C@@](CC)(C[C@H](/C=C/C(C)=O)CC)OC1=O |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00040040 81000000 00000100 80010300 00180000 00000800 02000080 08000402 01000000 00100000 40000000 40009000 04028000 00000000 00000400 00081008 00820010 00000000 00412010 00002001 00000020 00000a80 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 |