On Target CASP1_HUMAN 0.56989247/CHEMBL400514
For the given ligand TCA, we have found in our database that, being scored 0.56989247, the most similar ligand is CHEMBL400514. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL400514 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | C=C1[C@@]2(C)C[C@H]3C(C)=C4CC(=O)OC(C)(C)C4=CC[C@]3(C)[C@]1(C(=O)OC)C(=O)[C@@](C)(O)C2=O |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050000 81040000 00800900 80010300 c0380000 00200801 02000040 08000402 00000140 00128008 40000200 4000d000 14028028 00800000 00000404 0008100c 00820000 00000000 32402090 0200a001 00000030 00001a00 0100a000 00000012 00201400 00000400 00406200 80000000 00000200 80000002 24020000 00800010 |