On Target CHLE_HUMAN 0.43617022/CHEMBL3586200
For the given ligand TCA, we have found in our database that, being scored 0.43617022, the most similar ligand is CHEMBL3586200. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3586200 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | C[C@@]12CC[C@@H]3[C@](C)(CC[C@H](OC(=O)CCc4ccc(O)cc4)[C@]3(C)C(=O)O)[C@H]1CC[C@H]1C(=CC[C@H]3[C@@](C)(CO)[C@H](O)CC[C@]13C)C2 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00010040 01000008 20000100 00010300 000c0040 00200000 02000000 00000402 00000800 01180848 08100000 40009000 1402800a 00800000 00000400 00081008 00820000 02000020 03402008 00020001 00000120 08000a00 01008040 00400010 00200c00 80000000 0052c000 80001000 00000200 0002000a 24020000 00000400 |