On Target TNFA_HUMAN 0.24468085/CHEMBL2337623
For the given ligand TCA, we have found in our database that, being scored 0.24468085, the most similar ligand is CHEMBL2337623. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL2337623 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCCCOC(=O)/C=C/c1cc(OC)c(O)c2c1C[C@@H]1[C@@H]3C=C(OC)C(=O)C[C@]23CCN1C |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 100d0000 4b000208 2010010a 00110700 20081021 c0002002 870c0180 2000060b 01800880 001888ca 48300000 5191d040 8402c01a 20a00000 03000423 020cb00a 20820600 82000060 2049a018 00020201 00100120 18200a90 0100c001 81540010 00201c00 80002001 04526008 d0000580 04404202 0026c50a 2c020000 00012710 |