On Target DRD2_HUMAN 0.3137255/CHEMBL75860
For the given ligand TCA, we have found in our database that, being scored 0.3137255, the most similar ligand is CHEMBL75860. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL75860 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | C(COCC1CCN(Cc2ccccc2)CC1)=C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00040000 01000000 00100100 00010700 00100000 00000000 82000080 23001400 00000000 000808c0 48200000 50018000 04000802 00000000 00000402 00081008 00000400 02000000 20400018 00000201 00000020 18008000 01000000 00500010 00001400 e0000000 00402200 d0000400 00400380 00060002 24040000 00000e10 |