On Target OPRK_HUMAN 0.5/CHEMBL1773748
For the given ligand TCA, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL1773748. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL1773748 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | COC(=O)C1=C(C(=O)OC)C2OC1C=C2[C@@H]1C[C@]2(C)[C@H]3C(=O)[C@@H](OC(C)=O)C[C@@H](C(=O)OC)[C@]3(C)CC[C@H]2C(=O)O1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050042 81000000 00000100 80090380 803c0040 00200800 02000080 0a000402 01000000 01120000 40000000 4000d001 14028028 02800000 00000400 00081008 00820010 80000100 33612010 02022001 00000021 10000a80 01008000 00000814 00201400 00001400 00404000 80000000 00000202 8000000a 24020000 02800010 |