On Target AA1R_HUMAN 0.29577464/CHEMBL3314905
For the given ligand TCA, we have found in our database that, being scored 0.29577464, the most similar ligand is CHEMBL3314905. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3314905 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | C=C(CCC)C1=CC=C(CC2CCCCCCC2)C2C=C(C3=CC=CC3)C=C12 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00000402 01040000 00000000 00000000 40010000 00000001 00000000 00000402 00000000 00100000 00000000 40400200 00020000 00000000 00000600 00000004 00000000 00000000 00002080 00020001 00002001 00000000 00008000 00000812 00200000 00000000 00404200 80000000 00000000 00000000 24820000 00000000 |