On Target AOFB_HUMAN 0.31707317/CHEMBL4636696
For the given ligand TCA, we have found in our database that, being scored 0.31707317, the most similar ligand is CHEMBL4636696. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL4636696 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC1=C(C)C(=O)C(O)=C(O)C1=O |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00000002 01000000 00000800 00080000 00090000 00000000 00000280 02000402 01000000 00100008 00000200 40405000 84028000 00000000 00000404 00080408 00000000 00000000 00650000 02020001 00000001 00000280 01008000 00000810 00200000 00000000 00404240 80000000 00014000 80000000 04000000 00000000 |