On Target MDR1_HUMAN 0.61333334/CHEMBL2074838
For the given ligand TCA, we have found in our database that, being scored 0.61333334, the most similar ligand is CHEMBL2074838. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL2074838 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCCCCC(O)CCCCC(O)C1CCC(C2CCC(C(O)CCCCCCCCCCC3=CC(C)OC3=O)O2)O1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00010040 01000000 00000000 00010300 00180000 00000800 02000000 08000442 01002000 00100000 40000000 40009000 04028008 02800000 00080400 000a9008 00820010 00000000 00412010 00000001 00000020 00000a80 05008000 08000010 00201400 00000400 00404000 80000020 00000200 00000000 24020000 00800010 |