On Target AGTR2_HUMAN 0.15384616/CHEMBL423236
For the given ligand TCA, we have found in our database that, being scored 0.15384616, the most similar ligand is CHEMBL423236. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL423236 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCOC(=O)C1Cc2c(ccc(OC)c2OCc2ccccc2)CN1C(=O)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 04008008 46805008 20100108 90210700 000010a0 c0004000 07041000 03001204 00000980 00080840 08300000 4000b0c0 0780c882 20210080 c1081489 0208b008 90020200 02008020 00480008 00020201 80020120 18208e20 13004040 81c49418 00004c00 e0002001 00a24000 c0000001 04000380 0087000b 60046000 00002600 |