On Target OPRM_MOUSE 0.29/CHEMBL2057689
For the given ligand TCA, we have found in our database that, being scored 0.29, the most similar ligand is CHEMBL2057689. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL2057689 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | O=C1CC[C@@]2(O)[C@H]3CC4=C(CCCC4)[C@@]2(CCN3CC2CC2)C1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050000 89000000 00100800 00000400 00180080 00000000 00080000 20000402 10000000 00100088 00200200 51011000 0402801a 01800000 00080404 00080008 10004000 00000060 02402000 02002201 00000000 10000210 03008000 00100010 00200000 00000000 00404000 90000000 04000000 80040400 24020000 00002a00 |