On Target P2Y12_HUMAN 0.2195122/CHEMBL509456
For the given ligand TCA, we have found in our database that, being scored 0.2195122, the most similar ligand is CHEMBL509456. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL509456 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)O)[C@@H](O)CCCC(=O)O |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00010402 43040000 20020020 00100400 41080000 00000001 00000000 00000402 04208000 00144040 00001200 40023000 04038028 02840000 00010404 0008000c 14800000 00000000 00402080 00620001 40002001 00000a00 03008700 00200812 00218200 00000010 00404000 80000010 00001000 40140120 24820000 07010000 |