On Target NOS2_HUMAN 0.36486486/CHEMBL1765578
For the given ligand TCA, we have found in our database that, being scored 0.36486486, the most similar ligand is CHEMBL1765578. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL1765578 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=CC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00010002 01000000 00000000 00080000 00080000 00000000 00000080 00000402 01000000 00128000 00000000 40001000 04028028 00800000 00000400 00080008 00000000 00000020 02412000 00020001 00000001 00000a80 01008000 00000810 00200000 00000000 00404000 80000000 00000000 00000000 24020000 00000000 |