On Target SCN9A_HUMAN 0.27891156/CHEMBL3657902
For the given ligand TCA, we have found in our database that, being scored 0.27891156, the most similar ligand is CHEMBL3657902. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3657902 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC1(C)[C@H]2CC=C(COc3cc(F)c(C(=O)NS(C)(=O)=O)cc3Cl)[C@@H]1C2 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 04008000 09000828 20180109 03710700 00081000 02000810 06040001 08001402 00000000 0010b840 40102000 40008800 02828846 01801011 91000409 00082008 02800200 02100020 00c02010 00024009 00040000 0802c700 01008000 00400014 02203001 80008c00 40624000 8000000d 00000200 00068800 a4060010 00030370 |