On Target PRGR_HUMAN 0.6857143/CHEMBL3695600
For the given ligand TCA, we have found in our database that, being scored 0.6857143, the most similar ligand is CHEMBL3695600. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3695600 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | C=C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@@]3(C)[C@@H](CC[C@@]34C=CC(=O)O4)[C@H]12 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050000 01000000 00000100 00010300 00090000 00000000 02000080 08000402 01000000 00108000 00000000 40409000 04028008 00800000 00000400 00081008 00820010 00000020 02412010 00000001 00000020 00000a80 01008000 00000010 00201400 00000400 00404000 80000000 00000200 01000002 24020000 00800010 |