On Target DRD4_HUMAN 0.24770643/CHEMBL299479
For the given ligand TCA, we have found in our database that, being scored 0.24770643, the most similar ligand is CHEMBL299479. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL299479 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | O=C(OCC1CCN(Cc2ccccc2)CC1)c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00008000 01000800 00100100 00010700 00100010 00004000 00000000 22001000 00000100 000808c0 00200000 50018800 02008886 00010000 00000400 02081008 00020000 02000000 00400000 00000201 00000020 18028b20 01000000 00500014 00002400 c0002000 000c0200 90000000 00000300 00060002 e0040000 02020a00 |