On Target OPRX_HUMAN 0.24271844/CHEMBL3325748
For the given ligand TCA, we have found in our database that, being scored 0.24271844, the most similar ligand is CHEMBL3325748. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3325748 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CN(C)[C@]1(c2ccccc2)CC[C@@H](OCc2ccccc2)CC1.Cl |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00000000 01000000 00100102 00010700 00180010 00004000 00000000 02001000 00000900 000808c0 08300000 40018000 00000800 00a10000 00000000 02081008 00800000 02000000 02402000 00000001 00000120 18008030 01000000 00500010 00000400 80002000 00080200 90000000 00000302 00060002 40060000 02020e00 |