On Target CAH2_HUMAN 0.3448276/CHEMBL3329923
For the given ligand TCA, we have found in our database that, being scored 0.3448276, the most similar ligand is CHEMBL3329923. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL3329923 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | COc1ccc2cc(/C=C/C(=O)C[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2c1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00050040 81000008 20000708 80010300 802c1040 00200000 82000080 00000440 01802000 01100848 00000000 40009000 1402802a 02800000 01000403 000a9008 00820400 02000100 1141a000 00022001 00000020 18000a08 05008020 08400010 01000400 80000000 00406000 c0000020 00400200 0002000a 24020000 00000000 |