On Target ESR1_HUMAN 0.42424244/CHEMBL4072205
For the given ligand TCA, we have found in our database that, being scored 0.42424244, the most similar ligand is CHEMBL4072205. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL4072205 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC(C)CCCCCOC(=O)/C=C/c1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00040000 01000008 20000300 00010300 00080000 00000000 82000080 01000400 01800100 00180840 48000000 40008800 04028002 00800000 00000402 00081008 00820400 02000000 2241a018 00020001 01000020 08000a00 01008021 00400010 01001400 a0000000 00526000 c0000400 00400280 00020002 24020000 00000410 |