On Target MIF_HUMAN 0.3955224/CHEMBL2375653
For the given ligand TCA, we have found in our database that, being scored 0.3955224, the most similar ligand is CHEMBL2375653. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL2375653 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | CC1=C[C@]2(C)/C=C(C)/C=C/C[C@@H](O)/C=C3/C=C/C(=C4\C(=O)O[C@]2(C[C@@H]1C)C4=O)OC3 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 0005044a 81040000 00000900 90010301 400d0001 00200801 02000100 08011402 01000100 00108040 48000200 4040d091 94028008 20824000 02080405 0008100c 00820004 80000020 204d6090 0202a001 20002021 00005a00 0140a000 00000816 00201400 80001400 00407200 80000000 00004242 80000002 3682a000 06000010 |