On Target HRH1_HUMAN 0.30097088/CHEMBL1101
For the given ligand TCA, we have found in our database that, being scored 0.30097088, the most similar ligand is CHEMBL1101. Check out the elaboration below.
| TCA (Given Ligand) | CHEMBL1101 (Similar Ligand) |
|---|---|
| C=C(C)C1C/C=C(C)\C(OC(C)=O)C1 | OC(CCN1CCCCC1)(c1ccccc1)C1CC2C=CC1C2 |
|
|
|
|
|
|
| 00000000 81000000 00000100 80010300 00190000 00000800 02000000 08000402 00000000 00100008 40000000 40408000 00028000 00000000 00000400 00081008 00820000 00000020 20402010 00000001 00000020 00000a00 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 | 00000000 81000200 00100102 00010600 00080000 00004000 00000000 20000402 00000900 001808c8 08300000 50018000 00020002 00a00000 00000400 000c0008 00000000 02000020 00c02000 00002201 00000100 18000030 01008080 00500010 00200001 80202000 00404000 90000000 00000002 0106000a 64020000 00002600 |