On Target PDE5A_HUMAN 0.011627907/CHEMBL454606
For the given ligand 1, we have found in our database that, being scored 0.011627907, the most similar ligand is CHEMBL454606. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL454606 (Similar Ligand) |
|---|---|
| CC | CCOC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00000800 02004100 10010200 000c0070 00004000 00008000 00000000 10000300 00000840 00080004 40008000 00008800 00d10000 00060040 020c000c 08028000 02800004 00200000 00400000 40000000 08068a68 a1806006 80400104 00000400 80002000 00088040 00000000 00400204 00020c01 c0040200 00000400 |