On Target MK01_HUMAN 0.025/CHEMBL38
For the given ligand 1, we have found in our database that, being scored 0.025, the most similar ligand is CHEMBL38. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL38 (Similar Ligand) |
|---|---|
| CC | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)C(C)(C)CCC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000400 01040000 00000000 00000000 40000000 00000001 00000000 00000402 01000000 00100000 00000000 40000000 00028000 20020000 00000400 0008000c 00000000 00000020 00092090 00000001 00000000 00000a00 00408000 00000012 00201000 00000000 00404000 80000000 00000000 00000000 24820000 00000000 |