On Target CHLE_HUMAN 0.05263158/CHEMBL498645
For the given ligand 1, we have found in our database that, being scored 0.05263158, the most similar ligand is CHEMBL498645. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL498645 (Similar Ligand) |
|---|---|
| CC | C[C@@H]([C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](N)CC[C@]4(C)[C@H]3CC[C@]12C)N(C)C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 01000000 00100000 00000400 00000000 00000000 00000000 00000000 00000000 00000080 00200000 40010000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 10000010 00000000 00100010 00000000 00000000 00000000 10000000 00000000 01040000 00020000 00000200 |