On Target TRPM4_HUMAN 0.010204081/CHEMBL1408302
For the given ligand 1, we have found in our database that, being scored 0.010204081, the most similar ligand is CHEMBL1408302. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL1408302 (Similar Ligand) |
|---|---|
| CC | O=C(COc1cccc2ccccc12)Nc1cc(Cl)ccc1C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1401e002 00000808 20001108 01010602 00001080 00014040 0a000000 00080100 00800100 00080840 002c0084 4000d800 06808086 00100001 01021041 00080008 00040000 82000000 08000000 00024000 40100000 08060f28 32002000 00400004 00002000 80000000 08040018 00001080 00008200 00060001 c0000000 00020200 |