On Target AOFB_HUMAN 0.035714287/CHEMBL198810
For the given ligand 1, we have found in our database that, being scored 0.035714287, the most similar ligand is CHEMBL198810. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL198810 (Similar Ligand) |
|---|---|
| CC | C(/C=C/c1ccccc1)=C\c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 00040000 00000100 00010200 00000000 00000001 80000080 00000400 00000000 00000840 00000000 40008000 00000000 00000000 00000002 00000000 00000400 02000000 00000080 00000000 00000010 08000000 00000000 00400000 00000000 80000000 00402000 40000000 00400000 08020000 04000000 01000000 |