On Target NMDE2_HUMAN 0.022222223/CHEMBL159530
For the given ligand 1, we have found in our database that, being scored 0.022222223, the most similar ligand is CHEMBL159530. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL159530 (Similar Ligand) |
|---|---|
| CC | N=C(NCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 00000000 00100100 00010600 00000000 00000000 00000400 02001000 00000100 00000853 00200000 40008800 80000802 01000000 00000400 00180000 00002000 02000000 00000000 00000000 00000000 08008000 00000000 00400000 00000000 c0000000 40000100 90000000 00000118 00060000 40140000 00000200 |