On Target SCN9A_HUMAN 0.015873017/CHEMBL4288200
For the given ligand 1, we have found in our database that, being scored 0.015873017, the most similar ligand is CHEMBL4288200. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL4288200 (Similar Ligand) |
|---|---|
| CC | O=C(NCc1ccccc1)[C@@H](c1ccccc1)N1CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 00800000 00100100 04010600 00000000 00000000 00000000 02001000 00000080 00090840 08200000 4000b000 03008802 00002001 40000400 00000000 00000000 02000000 00000000 00000200 80000000 38208600 00000022 83400018 00000000 c0000000 00000000 80000000 0c000100 00060003 20046000 00000600 |