On Target PRGR_HUMAN 0.032258064/CHEMBL1684463
For the given ligand 1, we have found in our database that, being scored 0.032258064, the most similar ligand is CHEMBL1684463. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL1684463 (Similar Ligand) |
|---|---|
| CC | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4CCC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01000000 00000000 00000000 00000000 00000000 00000000 00000402 00000000 00108000 00000000 40001000 04028008 00000000 00000400 00000000 00000000 00000020 02002000 02000001 00000000 00000200 00008000 00000010 00200000 00000000 00404000 80001000 00000000 81000000 24020000 00000000 |