On Target IKKB_HUMAN 0.01923077/CHEMBL482477
For the given ligand 1, we have found in our database that, being scored 0.01923077, the most similar ligand is CHEMBL482477. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL482477 (Similar Ligand) |
|---|---|
| CC | CCCCC/C=C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010002 01040000 00000000 00080000 40090000 00000001 00000080 00000402 01000000 00108008 00000000 40401000 04028000 20000000 00000400 0008000c 00000000 00000000 00492080 00020001 00002001 00000a80 01008000 00000812 00200000 00200000 00404000 80000000 00000000 80000000 24000000 00000000 |