On Target NMDZ1_HUMAN 0.20444444/CHEMBL162577
For the given ligand Aspirin, we have found in our database that, being scored 0.20444444, the most similar ligand is CHEMBL162577. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL162577 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1ccc(N2C(=O)CN(Cc3c(C(=O)O)[nH]c4cc(Cl)cc(Cl)c34)C2=O)cc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 1001c006 09802808 20000128 14010e10 000c1020 0000c020 06004084 0a003009 00000300 00090a48 01280004 4000a800 060088ae 0070a400 810204c1 020c000c 0006c008 02c0200c 08200040 00020001 c0120100 28078fe8 20822002 8240011e 00146000 c0000400 08044000 80000080 08008304 00060001 e004c200 80424220 |