On Target PERM_HUMAN 0.2635659/CHEMBL3920217
For the given ligand Aspirin, we have found in our database that, being scored 0.2635659, the most similar ligand is CHEMBL3920217. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3920217 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | Oc1ccccc1CCCNCc1ccccc1O |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 00000208 20100100 00010600 00000000 00000000 02000000 22001600 00000800 001808c0 08300000 40008040 00000802 00000000 00000400 00042008 00000000 02000000 00000000 00020201 00000100 18008000 00000000 00400010 00000000 c0000000 00000000 90000000 00000100 0006800a 24040000 00000600 |