On Target TRPV1_RAT 0.42682928/CHEMBL104647
For the given ligand Aspirin, we have found in our database that, being scored 0.42682928, the most similar ligand is CHEMBL104647. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL104647 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1cc(CC(=O)OCC2=C[C@H]3[C@@H]4C(C)(C)[C@]4(OC(C)=O)[C@H](OC(=O)Cc4ccccc4)[C@@H](C)[C@]3(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)C2)ccc1O |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00050040 c3000008 20000d08 80010300 00381041 00000800 02000280 28000442 01002000 01180848 48000200 4000d000 0502c02a 23800000 41040405 00089008 08820000 02000000 37492010 02022201 00010020 08000a80 05008000 08400010 00201480 80200400 00524200 80011020 00000200 8002000a 24022000 00800410 |