On Target FABP5_HUMAN 0.4/CHEMBL4292072
For the given ligand Aspirin, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL4292072. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4292072 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | O=C(O)C1C(c2ccccc2)C(C(=O)Oc2cccc3ccccc23)C1c1ccccc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04010000 01000008 2000010a 00010300 00081000 02000000 02000000 00000000 00000800 000a0840 08100000 40009000 0480802a 02a00010 11010001 000a2008 00820000 02000000 00402008 00020001 00000100 08000a08 11000040 00400010 00000800 80000000 00000000 00000000 00000202 00020002 00000000 10000400 |