On Target SC6A4_HUMAN 0.40650406/CHEMBL1201151
For the given ligand Aspirin, we have found in our database that, being scored 0.40650406, the most similar ligand is CHEMBL1201151. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1201151 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 43000008 2000010a 00010200 00483000 40000002 02040000 00000001 00000800 00080840 08100080 40008000 00000002 20a00000 01000021 00090008 00000200 02000000 02482000 00020201 00000108 08000000 01004000 00400010 00000000 80000001 00120000 00000000 00000202 01020202 00020800 00000400 |