On Target TRPV3_HUMAN 0.32768363/CHEMBL3664218
For the given ligand Aspirin, we have found in our database that, being scored 0.32768363, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc3ccc(Cl)cc32)c1OC1CCCC1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |