On Target AOFA_HUMAN 0.38317758/CHEMBL1070
For the given ligand Aspirin, we have found in our database that, being scored 0.38317758, the most similar ligand is CHEMBL1070. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1070 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1ccc2cc(CCC(C)=O)ccc2c1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 01000008 2000010a 00010200 00001000 00000000 02000000 00000000 00000800 00080840 08100000 40009000 04008002 00200000 01000001 00000008 00000000 02000000 00000008 00020001 00000100 08000208 00000000 00400010 00000800 80000000 00000000 00000000 00000200 00020002 00000000 00000400 |