On Target ADRB2_HUMAN 0.31304348/CHEMBL1714856
For the given ligand Aspirin, we have found in our database that, being scored 0.31304348, the most similar ligand is CHEMBL1714856. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1714856 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COC(=O)C1=C(c2cccc(OCc3ccccc3)c2)C[C@@H]2CC[C@H]1N2C(=O)NCc1cccc(F)c1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04010010 4b809208 2010030a 02010f00 00081040 40004810 82180184 3a003402 01800900 015828c8 49300000 51119000 0c82990a 20a11080 01000423 020c0108 20a24400 02000541 40c9a05a 00820201 80000100 18158eb0 010080a0 00d01018 01213083 80002401 00486000 d0010501 00400302 0006850b 6c0e0000 82002710 |