On Target PPARG_HUMAN 0.44444445/CHEMBL4460072
For the given ligand Aspirin, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL4460072. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4460072 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCCOC(=O)/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)cc(C)c2O1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04040040 c3000018 2000010a 80010300 00011001 c2000800 02000080 08000602 01000800 00180840 48100000 40409040 00828002 00200000 11000401 00082008 00020000 22008000 20412010 00022201 00000120 08000a80 01008040 00400010 00201400 c0000400 00484000 80000000 00000302 00024002 24020000 02000410 |