On Target PPAP_HUMAN 0.23178808/CHEMBL507996
For the given ligand Aspirin, we have found in our database that, being scored 0.23178808, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1ccc([C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O)cc1.Cl |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |