On Target ACM4_HUMAN 0.34306568/CHEMBL1101
For the given ligand Aspirin, we have found in our database that, being scored 0.34306568, the most similar ligand is CHEMBL1101. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1101 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | OC(CCN1CCCCC1)(c1ccccc1)C1CC2C=CC1C2 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 81000200 00100102 00010600 00080000 00004000 00000000 20000402 00000900 001808c8 08300000 50018000 00020002 00a00000 00000400 000c0008 00000000 02000020 00c02000 00002201 00000100 18000030 01008080 00500010 00200001 80202000 00404000 90000000 00000002 0106000a 64020000 00002600 |